C13H24OSi — CID 122377729
tert-butyl-[(E,3R)-hept-4-en-6-yn-3-yl]oxy-dimethylsilane (PubChem CID 122377729) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is tert-butyl-[(E,3R)-hept-4-en-6-yn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3R)-hept-4-en-6-yn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 122377729 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | tert-butyl-[(E,3R)-hept-4-en-6-yn-3-yl]oxy-dimethylsilane |
| SMILES | C#C/C=C/[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24OSi/c1-8-10-11-12(9-2)14-15(6,7)13(3,4)5/h1,10-12H,9H2,2-7H3/b11-10+/t12-/m1/s1 |
| InChIKey | WBTZLCFRQBIRPU-HCRIHEDKSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|