C28H27N5O — CID 122377739
12-(4-methoxyphenyl)-14-methyl-16-phenyl-2,15,16,18-tetrazatetracyclo[9.7.0.03,9.013,17]octadeca-1,3(9),10,12,14,17-hexaen-10-amine (PubChem CID 122377739) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is 12-(4-methoxyphenyl)-14-methyl-16-phenyl-2,15,16,18-tetrazatetracyclo[9.7.0.03,9.013,17]octadeca-1,3(9),10,12,14,17-hexaen-10-amine.
| Compound Name | 12-(4-methoxyphenyl)-14-methyl-16-phenyl-2,15,16,18-tetrazatetracyclo[9.7.0.03,9.013,17]octadeca-1,3(9),10,12,14,17-hexaen-10-amine |
|---|---|
| PubChem CID | 122377739 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 12-(4-methoxyphenyl)-14-methyl-16-phenyl-2,15,16,18-tetrazatetracyclo[9.7.0.03,9.013,17]octadeca-1,3(9),10,12,14,17-hexaen-10-amine |
| SMILES | COc1ccc(-c2c3c(N)c4c(nc3nc3c2c(C)nn3-c2ccccc2)CCCCC4)cc1 |
| InChI | InChI=1S/C28H27N5O/c1-17-23-24(18-13-15-20(34-2)16-14-18)25-26(29)21-11-7-4-8-12-22(21)30-27(25)31-28(23)33(32-17)19-9-5-3-6-10-19/h3,5-6,9-10,13-16H,4,7-8,11-12H2,1-2H3,(H2,29,30,31) |
| InChIKey | JKBPNXWCCCNIHZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |