C27H25N5O — CID 122377740
11-(4-methoxyphenyl)-13-methyl-15-phenyl-2,14,15,17-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9,11,13,16-hexaen-9-amine (PubChem CID 122377740) has the molecular formula C27H25N5O and a molecular weight of 435.53 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-13-methyl-15-phenyl-2,14,15,17-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9,11,13,16-hexaen-9-amine.
| Compound Name | 11-(4-methoxyphenyl)-13-methyl-15-phenyl-2,14,15,17-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9,11,13,16-hexaen-9-amine |
|---|---|
| PubChem CID | 122377740 |
| Molecular Formula | C27H25N5O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 11-(4-methoxyphenyl)-13-methyl-15-phenyl-2,14,15,17-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9,11,13,16-hexaen-9-amine |
| SMILES | COc1ccc(-c2c3c(N)c4c(nc3nc3c2c(C)nn3-c2ccccc2)CCCC4)cc1 |
| InChI | InChI=1S/C27H25N5O/c1-16-22-23(17-12-14-19(33-2)15-13-17)24-25(28)20-10-6-7-11-21(20)29-26(24)30-27(22)32(31-16)18-8-4-3-5-9-18/h3-5,8-9,12-15H,6-7,10-11H2,1-2H3,(H2,28,29,30) |
| InChIKey | UWGOWNZLSNTARA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |