C24H39F3O5SSi — CID 122378289
[(3aS,5aR,6S,7S,9aS,9bS)-6-formyl-6,9a,9b-trimethyl-7-triethylsilyloxy-3,3a,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 122378289) has the molecular formula C24H39F3O5SSi and a molecular weight of 524.72 g/mol. Its IUPAC name is [(3aS,5aR,6S,7S,9aS,9bS)-6-formyl-6,9a,9b-trimethyl-7-triethylsilyloxy-3,3a,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3aS,5aR,6S,7S,9aS,9bS)-6-formyl-6,9a,9b-trimethyl-7-triethylsilyloxy-3,3a,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122378289 |
| Molecular Formula | C24H39F3O5SSi |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | [(3aS,5aR,6S,7S,9aS,9bS)-6-formyl-6,9a,9b-trimethyl-7-triethylsilyloxy-3,3a,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@H]3CC=C(OS(=O)(=O)C(F)(F)F)[C@@]32C)[C@]1(C)C=O |
| InChI | InChI=1S/C24H39F3O5SSi/c1-7-34(8-2,9-3)32-19-14-15-22(5)18(21(19,4)16-28)12-10-17-11-13-20(23(17,22)6)31-33(29,30)24(25,26)27/h13,16-19H,7-12,14-15H2,1-6H3/t17-,18-,19-,21-,22-,23+/m0/s1 |
| InChIKey | CFVDLIFHFPNPAC-XPDLTSPISA-N |
| XLogP | 6.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|