C46H51NO3 — CID 122378423
2-[2-[2-(methoxymethoxy)-3-[2-(4-methylphenyl)ethynyl]-5-pentylphenyl]ethynyl]-6-[2-(4-methylphenyl)ethynyl]-4-octoxypyridine (PubChem CID 122378423) has the molecular formula C46H51NO3 and a molecular weight of 665.92 g/mol. Its IUPAC name is 2-[2-[2-(methoxymethoxy)-3-[2-(4-methylphenyl)ethynyl]-5-pentylphenyl]ethynyl]-6-[2-(4-methylphenyl)ethynyl]-4-octoxypyridine.
| Compound Name | 2-[2-[2-(methoxymethoxy)-3-[2-(4-methylphenyl)ethynyl]-5-pentylphenyl]ethynyl]-6-[2-(4-methylphenyl)ethynyl]-4-octoxypyridine |
|---|---|
| PubChem CID | 122378423 |
| Molecular Formula | C46H51NO3 |
| Molecular Weight | 665.92 g/mol |
| Exact Mass | 665.39 |
| IUPAC Name | 2-[2-[2-(methoxymethoxy)-3-[2-(4-methylphenyl)ethynyl]-5-pentylphenyl]ethynyl]-6-[2-(4-methylphenyl)ethynyl]-4-octoxypyridine |
| SMILES | CCCCCCCCOc1cc(C#Cc2ccc(C)cc2)nc(C#Cc2cc(CCCCC)cc(C#Cc3ccc(C)cc3)c2OCOC)c1 |
| InChI | InChI=1S/C46H51NO3/c1-6-8-10-11-12-14-30-49-45-33-43(28-25-39-22-18-37(4)19-23-39)47-44(34-45)29-27-42-32-40(15-13-9-7-2)31-41(46(42)50-35-48-5)26-24-38-20-16-36(3)17-21-38/h16-23,31-34H,6-15,30,35H2,1-5H3 |
| InChIKey | OPXPXSQDVXJHKB-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.92 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|