C36H40IN2O4+ — CID 122378806
[2,6-bis[[(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]oxy]phenyl]-phenyliodanium (PubChem CID 122378806) has the molecular formula C36H40IN2O4+ and a molecular weight of 691.63 g/mol. Its IUPAC name is [2,6-bis[[(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]oxy]phenyl]-phenyliodanium.
| Compound Name | [2,6-bis[[(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]oxy]phenyl]-phenyliodanium |
|---|---|
| PubChem CID | 122378806 |
| Molecular Formula | C36H40IN2O4+ |
| Molecular Weight | 691.63 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | [2,6-bis[[(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]oxy]phenyl]-phenyliodanium |
| SMILES | Cc1cc(C)c(NC(=O)[C@@H](C)Oc2cccc(O[C@H](C)C(=O)Nc3c(C)cc(C)cc3C)c2[I+]c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C36H39IN2O4/c1-21-17-23(3)33(24(4)18-21)38-35(40)27(7)42-30-15-12-16-31(32(30)37-29-13-10-9-11-14-29)43-28(8)36(41)39-34-25(5)19-22(2)20-26(34)6/h9-20,27-28H,1-8H3,(H-,38,39,40,41)/p+1/t27-,28-/m1/s1 |
| InChIKey | ZMRTZLUVFPIKLL-VSGBNLITSA-O |
| XLogP | 4.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|