C13H19NO2 — CID 122378996
(3R)-N,N-diethyl-3-hydroxy-3-phenylpropanamide (PubChem CID 122378996) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3R)-N,N-diethyl-3-hydroxy-3-phenylpropanamide.
| Compound Name | (3R)-N,N-diethyl-3-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 122378996 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3R)-N,N-diethyl-3-hydroxy-3-phenylpropanamide |
| SMILES | CCN(CC)C(=O)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO2/c1-3-14(4-2)13(16)10-12(15)11-8-6-5-7-9-11/h5-9,12,15H,3-4,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | ORUFFNOSWLAXIB-GFCCVEGCSA-N |
| XLogP | 1.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |