C15H26O3 — CID 122379619
(E,5R)-6-methyl-5-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)hept-3-en-2-one (PubChem CID 122379619) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (E,5R)-6-methyl-5-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)hept-3-en-2-one.
| Compound Name | (E,5R)-6-methyl-5-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)hept-3-en-2-one |
|---|---|
| PubChem CID | 122379619 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (E,5R)-6-methyl-5-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)hept-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@@H](C(C)C)C1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H26O3/c1-10(2)12(9-8-11(3)16)13-17-14(4,5)15(6,7)18-13/h8-10,12-13H,1-7H3/b9-8+/t12-/m0/s1 |
| InChIKey | LPJGKIMJURQFQI-BCPZQOPPSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|