About [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate
[3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 122379746) has the molecular formula C17H16N4OS2
and a molecular weight of 356.48 g/mol. Its IUPAC name is [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate.
Molecular Properties
| Compound Name | [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate |
| PubChem CID | 122379746 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | O=C(CCSC(=S)NCc1cccnc1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C17H16N4OS2/c22-15(14-11-20-16-13(14)4-2-7-19-16)5-8-24-17(23)21-10-12-3-1-6-18-9-12/h1-4,6-7,9,11H,5,8,10H2,(H,19,20)(H,21,23) |
| InChIKey | DQUKSHZPHJYWNM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The IUPAC name of [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate (CID 122379746) is [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate.
What is the SMILES notation for [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The canonical SMILES for [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate is O=C(CCSC(=S)NCc1cccnc1)c1c[nH]c2ncccc12.
What is the InChIKey of [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The InChIKey is DQUKSHZPHJYWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4OS2/c22-15(14-11-20-16-13(14)4-2-7-19-16)5-8-24-17(23)21-10-12-3-1-6-18-9-12/h1-4,6-7,9,11H,5,8,10H2,(H,19,20)(H,21,23).
What are the key properties of [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate?
[3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate has a molecular weight of 356.48 g/mol, XLogP of 3.34, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-oxo-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate is sourced from PubChem (CID 122379746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).