C19H23ClFN7O2 — CID 122380021
1-[2-chloro-6-(2-fluoroethoxy)-4-pyridinyl]-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 122380021) has the molecular formula C19H23ClFN7O2 and a molecular weight of 435.89 g/mol. Its IUPAC name is 1-[2-chloro-6-(2-fluoroethoxy)-4-pyridinyl]-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-[2-chloro-6-(2-fluoroethoxy)-4-pyridinyl]-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 122380021 |
| Molecular Formula | C19H23ClFN7O2 |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[2-chloro-6-(2-fluoroethoxy)-4-pyridinyl]-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | Cc1nn(C)c2nc(NNC(=O)Nc3cc(Cl)nc(OCCF)c3)cc(C(C)C)c12 |
| InChI | InChI=1S/C19H23ClFN7O2/c1-10(2)13-9-15(24-18-17(13)11(3)27-28(18)4)25-26-19(29)22-12-7-14(20)23-16(8-12)30-6-5-21/h7-10H,5-6H2,1-4H3,(H,24,25)(H2,22,23,26,29) |
| InChIKey | NHCXEOUEDQZASO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|