C30H29NO3 — CID 122380214
ethyl (3aS,4S)-1-benzhydryl-6-oxo-4-phenyl-3,3a,4,5-tetrahydro-2H-indole-7-carboxylate (PubChem CID 122380214) has the molecular formula C30H29NO3 and a molecular weight of 451.57 g/mol. Its IUPAC name is ethyl (3aS,4S)-1-benzhydryl-6-oxo-4-phenyl-3,3a,4,5-tetrahydro-2H-indole-7-carboxylate.
| Compound Name | ethyl (3aS,4S)-1-benzhydryl-6-oxo-4-phenyl-3,3a,4,5-tetrahydro-2H-indole-7-carboxylate |
|---|---|
| PubChem CID | 122380214 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | ethyl (3aS,4S)-1-benzhydryl-6-oxo-4-phenyl-3,3a,4,5-tetrahydro-2H-indole-7-carboxylate |
| SMILES | CCOC(=O)C1=C2[C@@H](CCN2C(c2ccccc2)c2ccccc2)[C@@H](c2ccccc2)CC1=O |
| InChI | InChI=1S/C30H29NO3/c1-2-34-30(33)27-26(32)20-25(21-12-6-3-7-13-21)24-18-19-31(29(24)27)28(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,24-25,28H,2,18-20H2,1H3/t24-,25+/m0/s1 |
| InChIKey | WYGKRUXNPFBGMS-LOSJGSFVSA-N |
| XLogP | 5.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|