About 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine
3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine (PubChem CID 122380275) has the molecular formula C24H23FN2O4S
and a molecular weight of 454.52 g/mol. Its IUPAC name is 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine.
Molecular Properties
| Compound Name | 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine |
| PubChem CID | 122380275 |
| Molecular Formula | C24H23FN2O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine |
| SMILES | CC1(F)CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C24H23FN2O4S/c1-23(25)16-24(19-8-4-2-5-9-19,20-10-6-3-7-11-20)18-26(17-23)32(30,31)22-14-12-21(13-15-22)27(28)29/h2-15H,16-18H2,1H3 |
| InChIKey | ZHUXSYZBNBAXDY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine?
The IUPAC name of 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine (CID 122380275) is 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine.
What is the SMILES notation for 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine?
The canonical SMILES for 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine is CC1(F)CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC(c2ccccc2)(c2ccccc2)C1.
What is the InChIKey of 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine?
The InChIKey is ZHUXSYZBNBAXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23FN2O4S/c1-23(25)16-24(19-8-4-2-5-9-19,20-10-6-3-7-11-20)18-26(17-23)32(30,31)22-14-12-21(13-15-22)27(28)29/h2-15H,16-18H2,1H3.
What are the key properties of 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine?
3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine has a molecular weight of 454.52 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-methyl-1-(4-nitrophenyl)sulfonyl-5,5-diphenylpiperidine is sourced from PubChem (CID 122380275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).