C8H6N8O9 — CID 122380420
1-[(3,4-dinitropyrazol-1-yl)methoxymethyl]-3,4-dinitropyrazole (PubChem CID 122380420) has the molecular formula C8H6N8O9 and a molecular weight of 358.18 g/mol. Its IUPAC name is 1-[(3,4-dinitropyrazol-1-yl)methoxymethyl]-3,4-dinitropyrazole.
| Compound Name | 1-[(3,4-dinitropyrazol-1-yl)methoxymethyl]-3,4-dinitropyrazole |
|---|---|
| PubChem CID | 122380420 |
| Molecular Formula | C8H6N8O9 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 1-[(3,4-dinitropyrazol-1-yl)methoxymethyl]-3,4-dinitropyrazole |
| SMILES | O=[N+]([O-])c1cn(COCn2cc([N+](=O)[O-])c([N+](=O)[O-])n2)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6N8O9/c17-13(18)5-1-11(9-7(5)15(21)22)3-25-4-12-2-6(14(19)20)8(10-12)16(23)24/h1-2H,3-4H2 |
| InChIKey | NXPGHOCMQPZVGE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 217.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|