C25H36O3 — CID 122380463
ethyl (8S,9S,10S,13R,14S)-4,4,8,13-tetramethyl-17-methylidene-3-oxo-2,7,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-10-carboxylate (PubChem CID 122380463) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is ethyl (8S,9S,10S,13R,14S)-4,4,8,13-tetramethyl-17-methylidene-3-oxo-2,7,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-10-carboxylate.
| Compound Name | ethyl (8S,9S,10S,13R,14S)-4,4,8,13-tetramethyl-17-methylidene-3-oxo-2,7,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-10-carboxylate |
|---|---|
| PubChem CID | 122380463 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | ethyl (8S,9S,10S,13R,14S)-4,4,8,13-tetramethyl-17-methylidene-3-oxo-2,7,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-10-carboxylate |
| SMILES | C=C1CC[C@H]2[C@]3(C)CC=C4C(C)(C)C(=O)CC[C@]4(C(=O)OCC)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C25H36O3/c1-7-28-21(27)25-15-12-20(26)22(3,4)17(25)10-14-24(6)18-9-8-16(2)23(18,5)13-11-19(24)25/h10,18-19H,2,7-9,11-15H2,1,3-6H3/t18-,19+,23+,24+,25-/m1/s1 |
| InChIKey | PPDYJTSXRDBJOE-KJDMZOHVSA-N |
| XLogP | 5.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|