C16H32O2Si — CID 122380932
tert-butyl-[[(2S,5R)-5-butyl-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane (PubChem CID 122380932) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is tert-butyl-[[(2S,5R)-5-butyl-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,5R)-5-butyl-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 122380932 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl-[[(2S,5R)-5-butyl-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane |
| SMILES | CCCC[C@@H]1C=C(C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H32O2Si/c1-8-9-10-14-11-13(2)15(18-14)12-17-19(6,7)16(3,4)5/h11,14-15H,8-10,12H2,1-7H3/t14-,15-/m1/s1 |
| InChIKey | YCOQHVRZACLCDR-HUUCEWRRSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|