C85H126S8 — CID 122380987
2-[[4-[7-[4-[[4,5-bis(decylsulfanyl)-1,3-dithiol-2-ylidene]methyl]phenyl]-9,9-dihexylfluoren-2-yl]phenyl]methylidene]-4,5-bis(decylsulfanyl)-1,3-dithiole (PubChem CID 122380987) has the molecular formula C85H126S8 and a molecular weight of 1404.48 g/mol. Its IUPAC name is 2-[[4-[7-[4-[[4,5-bis(decylsulfanyl)-1,3-dithiol-2-ylidene]methyl]phenyl]-9,9-dihexylfluoren-2-yl]phenyl]methylidene]-4,5-bis(decylsulfanyl)-1,3-dithiole.
| Compound Name | 2-[[4-[7-[4-[[4,5-bis(decylsulfanyl)-1,3-dithiol-2-ylidene]methyl]phenyl]-9,9-dihexylfluoren-2-yl]phenyl]methylidene]-4,5-bis(decylsulfanyl)-1,3-dithiole |
|---|---|
| PubChem CID | 122380987 |
| Molecular Formula | C85H126S8 |
| Molecular Weight | 1404.48 g/mol |
| Exact Mass | 1402.76 |
| IUPAC Name | 2-[[4-[7-[4-[[4,5-bis(decylsulfanyl)-1,3-dithiol-2-ylidene]methyl]phenyl]-9,9-dihexylfluoren-2-yl]phenyl]methylidene]-4,5-bis(decylsulfanyl)-1,3-dithiole |
| SMILES | CCCCCCCCCCSC1=C(SCCCCCCCCCC)SC(=Cc2ccc(-c3ccc4c(c3)C(CCCCCC)(CCCCCC)c3cc(-c5ccc(C=C6SC(SCCCCCCCCCC)=C(SCCCCCCCCCC)S6)cc5)ccc3-4)cc2)S1 |
| InChI | InChI=1S/C85H126S8/c1-7-13-19-25-29-33-37-43-61-86-81-82(87-62-44-38-34-30-26-20-14-8-2)91-79(90-81)65-69-47-51-71(52-48-69)73-55-57-75-76-58-56-74(68-78(76)85(77(75)67-73,59-41-23-17-11-5)60-42-24-18-12-6)72-53-49-70(50-54-72)66-80-92-83(88-63-45-39-35-31-27-21-15-9-3)84(93-80)89-64-46-40-36-32-28-22-16-10-4/h47-58,65-68H,7-46,59-64H2,1-6H3 |
| InChIKey | PDAIMWNAIZEVQJ-UHFFFAOYSA-N |
| XLogP | 32.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1404.48 |
| LogP ≤ 5 | 32.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|