C13H21N4O+ — CID 122381062
3,5-dimethyl-1-[2-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]ethyl]pyrazole (PubChem CID 122381062) has the molecular formula C13H21N4O+ and a molecular weight of 249.34 g/mol. Its IUPAC name is 3,5-dimethyl-1-[2-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]ethyl]pyrazole.
| Compound Name | 3,5-dimethyl-1-[2-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]ethyl]pyrazole |
|---|---|
| PubChem CID | 122381062 |
| Molecular Formula | C13H21N4O+ |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3,5-dimethyl-1-[2-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]ethyl]pyrazole |
| SMILES | Cc1cc(C)n(CCOCCn2cc[n+](C)c2)n1 |
| InChI | InChI=1S/C13H21N4O/c1-12-10-13(2)17(14-12)7-9-18-8-6-16-5-4-15(3)11-16/h4-5,10-11H,6-9H2,1-3H3/q+1 |
| InChIKey | XIXPALGLNTYEIH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|