C12H6F6N2O2 — CID 122381181
3,6-bis(2,2,2-trifluoroethoxy)benzene-1,2-dicarbonitrile (PubChem CID 122381181) has the molecular formula C12H6F6N2O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 3,6-bis(2,2,2-trifluoroethoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3,6-bis(2,2,2-trifluoroethoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 122381181 |
| Molecular Formula | C12H6F6N2O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 3,6-bis(2,2,2-trifluoroethoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(OCC(F)(F)F)ccc(OCC(F)(F)F)c1C#N |
| InChI | InChI=1S/C12H6F6N2O2/c13-11(14,15)5-21-9-1-2-10(22-6-12(16,17)18)8(4-20)7(9)3-19/h1-2H,5-6H2 |
| InChIKey | CORWMYGMHAJLEO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |