C33H27NS3 — CID 122381530
(11R,12R)-8,11,12,15-tetramethyl-4,9,14-triphenyl-3,10,13-trithia-5-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,8,14-pentaene (PubChem CID 122381530) has the molecular formula C33H27NS3 and a molecular weight of 533.79 g/mol. Its IUPAC name is (11R,12R)-8,11,12,15-tetramethyl-4,9,14-triphenyl-3,10,13-trithia-5-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,8,14-pentaene.
| Compound Name | (11R,12R)-8,11,12,15-tetramethyl-4,9,14-triphenyl-3,10,13-trithia-5-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,8,14-pentaene |
|---|---|
| PubChem CID | 122381530 |
| Molecular Formula | C33H27NS3 |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | (11R,12R)-8,11,12,15-tetramethyl-4,9,14-triphenyl-3,10,13-trithia-5-azatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,8,14-pentaene |
| SMILES | CC1=C(c2ccccc2)S[C@]2(C)C1=c1nc(-c3ccccc3)sc1=C1C(C)=C(c3ccccc3)S[C@]12C |
| InChI | InChI=1S/C33H27NS3/c1-20-25-27-30(35-31(34-27)24-18-12-7-13-19-24)26-21(2)29(23-16-10-6-11-17-23)37-33(26,4)32(25,3)36-28(20)22-14-8-5-9-15-22/h5-19H,1-4H3/t32-,33-/m1/s1 |
| InChIKey | FHQPHECLGIRQIO-CZNDPXEESA-N |
| XLogP | 8.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |