About CID 122382059
CID 122382059 (PubChem CID 122382059) has the molecular formula C80H56O4Si4
and a molecular weight of 1193.67 g/mol.
Molecular Properties
| Compound Name | CID 122382059 |
| PubChem CID | 122382059 |
| Molecular Formula | C80H56O4Si4 |
| Molecular Weight | 1193.67 g/mol |
| Exact Mass | 1192.33 |
| IUPAC Name | — |
| SMILES | c1ccc(C2=C(c3ccccc3)[Si]3(O[Si]4(O[Si]5(O[Si]6(O3)c3ccccc3-c3ccccc36)C(c3ccccc3)=C(c3ccccc3)C(c3ccccc3)=C5c3ccccc3)c3ccccc3-c3ccccc34)C(c3ccccc3)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C80H56O4Si4/c1-9-33-57(34-10-1)73-74(58-35-11-2-12-36-58)78(62-43-19-6-20-44-62)87(77(73)61-41-17-5-18-42-61)81-85(69-53-29-25-49-65(69)66-50-26-30-54-70(66)85)83-88(84-86(82-87)71-55-31-27-51-67(71)68-52-28-32-56-72(68)86)79(63-45-21-7-22-46-63)75(59-37-13-3-14-38-59)76(60-39-15-4-16-40-60)80(88)64-47-23-8-24-48-64/h1-56H |
| InChIKey | DYUXDVBUWWGULK-UHFFFAOYSA-N |
| XLogP | 16.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 88 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1193.67 |
| LogP ≤ 5 | 16.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 122382059 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122382059?
The IUPAC name of CID 122382059 (CID 122382059) is not available.
What is the SMILES notation for CID 122382059?
The canonical SMILES for CID 122382059 is c1ccc(C2=C(c3ccccc3)[Si]3(O[Si]4(O[Si]5(O[Si]6(O3)c3ccccc3-c3ccccc36)C(c3ccccc3)=C(c3ccccc3)C(c3ccccc3)=C5c3ccccc3)c3ccccc3-c3ccccc34)C(c3ccccc3)=C2c2ccccc2)cc1.
What is the InChIKey of CID 122382059?
The InChIKey is DYUXDVBUWWGULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C80H56O4Si4/c1-9-33-57(34-10-1)73-74(58-35-11-2-12-36-58)78(62-43-19-6-20-44-62)87(77(73)61-41-17-5-18-42-61)81-85(69-53-29-25-49-65(69)66-50-26-30-54-70(66)85)83-88(84-86(82-87)71-55-31-27-51-67(71)68-52-28-32-56-72(68)86)79(63-45-21-7-22-46-63)75(59-37-13-3-14-38-59)76(60-39-15-4-16-40-60)80(88)64-47-23-8-24-48-64/h1-56H.
What are the key properties of CID 122382059?
CID 122382059 has a molecular weight of 1193.67 g/mol, XLogP of 16.05, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122382059 is sourced from PubChem (CID 122382059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).