About ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate
ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate (PubChem CID 122382316) has the molecular formula C15H13F3O4
and a molecular weight of 314.26 g/mol. Its IUPAC name is ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate |
| PubChem CID | 122382316 |
| Molecular Formula | C15H13F3O4 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate |
| SMILES | CCOC(=O)[C@](O)(c1ccc2ccccc2c1O)C(F)(F)F |
| InChI | InChI=1S/C15H13F3O4/c1-2-22-13(20)14(21,15(16,17)18)11-8-7-9-5-3-4-6-10(9)12(11)19/h3-8,19,21H,2H2,1H3/t14-/m1/s1 |
| InChIKey | LOTHHVBTCUJXKF-CQSZACIVSA-N |
| XLogP | 2.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate?
The IUPAC name of ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate (CID 122382316) is ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate.
What is the SMILES notation for ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate?
The canonical SMILES for ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate is CCOC(=O)[C@](O)(c1ccc2ccccc2c1O)C(F)(F)F.
What is the InChIKey of ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate?
The InChIKey is LOTHHVBTCUJXKF-CQSZACIVSA-N. The full InChI is InChI=1S/C15H13F3O4/c1-2-22-13(20)14(21,15(16,17)18)11-8-7-9-5-3-4-6-10(9)12(11)19/h3-8,19,21H,2H2,1H3/t14-/m1/s1.
What are the key properties of ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate?
ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate has a molecular weight of 314.26 g/mol, XLogP of 2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-(1-hydroxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 122382316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).