C27H34N2O6 — CID 122382500
(1E,4Z,6E)-1,7-bis[4-(dimethylamino)-2,6-dimethoxyphenyl]-5-hydroxyhepta-1,4,6-trien-3-one (PubChem CID 122382500) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is (1E,4Z,6E)-1,7-bis[4-(dimethylamino)-2,6-dimethoxyphenyl]-5-hydroxyhepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-1,7-bis[4-(dimethylamino)-2,6-dimethoxyphenyl]-5-hydroxyhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 122382500 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | (1E,4Z,6E)-1,7-bis[4-(dimethylamino)-2,6-dimethoxyphenyl]-5-hydroxyhepta-1,4,6-trien-3-one |
| SMILES | COc1cc(N(C)C)cc(OC)c1/C=C/C(=O)/C=C(O)/C=C/c1c(OC)cc(N(C)C)cc1OC |
| InChI | InChI=1S/C27H34N2O6/c1-28(2)18-13-24(32-5)22(25(14-18)33-6)11-9-20(30)17-21(31)10-12-23-26(34-7)15-19(29(3)4)16-27(23)35-8/h9-17,30H,1-8H3/b11-9+,12-10+,20-17- |
| InChIKey | FNCDISWYBBWDIH-GPZCBVGASA-N |
| XLogP | 4.59 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|