C16H20O3Si — CID 122382725
(3aR,6aR)-5-[dimethyl(phenyl)silyl]-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 122382725) has the molecular formula C16H20O3Si and a molecular weight of 288.42 g/mol. Its IUPAC name is (3aR,6aR)-5-[dimethyl(phenyl)silyl]-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6aR)-5-[dimethyl(phenyl)silyl]-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 122382725 |
| Molecular Formula | C16H20O3Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (3aR,6aR)-5-[dimethyl(phenyl)silyl]-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]2C=C([Si](C)(C)c3ccccc3)C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C16H20O3Si/c1-16(2)18-12-10-13(14(17)15(12)19-16)20(3,4)11-8-6-5-7-9-11/h5-10,12,15H,1-4H3/t12-,15-/m1/s1 |
| InChIKey | NQRUSXOAAUXNOO-IUODEOHRSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|