About (2Z)-2-triethylsilyloxyhepta-2,6-dienal
(2Z)-2-triethylsilyloxyhepta-2,6-dienal (PubChem CID 122383003) has the molecular formula C13H24O2Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is (2Z)-2-triethylsilyloxyhepta-2,6-dienal.
Molecular Properties
| Compound Name | (2Z)-2-triethylsilyloxyhepta-2,6-dienal |
| PubChem CID | 122383003 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (2Z)-2-triethylsilyloxyhepta-2,6-dienal |
| SMILES | C=CCC/C=C(/C=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C13H24O2Si/c1-5-9-10-11-13(12-14)15-16(6-2,7-3)8-4/h5,11-12H,1,6-10H2,2-4H3/b13-11- |
| InChIKey | ZJFXDJCCUZBUGY-QBFSEMIESA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-triethylsilyloxyhepta-2,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-triethylsilyloxyhepta-2,6-dienal?
The IUPAC name of (2Z)-2-triethylsilyloxyhepta-2,6-dienal (CID 122383003) is (2Z)-2-triethylsilyloxyhepta-2,6-dienal.
What is the SMILES notation for (2Z)-2-triethylsilyloxyhepta-2,6-dienal?
The canonical SMILES for (2Z)-2-triethylsilyloxyhepta-2,6-dienal is C=CCC/C=C(/C=O)O[Si](CC)(CC)CC.
What is the InChIKey of (2Z)-2-triethylsilyloxyhepta-2,6-dienal?
The InChIKey is ZJFXDJCCUZBUGY-QBFSEMIESA-N. The full InChI is InChI=1S/C13H24O2Si/c1-5-9-10-11-13(12-14)15-16(6-2,7-3)8-4/h5,11-12H,1,6-10H2,2-4H3/b13-11-.
What are the key properties of (2Z)-2-triethylsilyloxyhepta-2,6-dienal?
(2Z)-2-triethylsilyloxyhepta-2,6-dienal has a molecular weight of 240.42 g/mol, XLogP of 4.06, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-triethylsilyloxyhepta-2,6-dienal is sourced from PubChem (CID 122383003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).