C13H20O2 — CID 122383022
4-(3-hydroxy-2,6,6-trimethylcyclohexa-1,4-dien-1-yl)butan-2-one (PubChem CID 122383022) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-(3-hydroxy-2,6,6-trimethylcyclohexa-1,4-dien-1-yl)butan-2-one.
| Compound Name | 4-(3-hydroxy-2,6,6-trimethylcyclohexa-1,4-dien-1-yl)butan-2-one |
|---|---|
| PubChem CID | 122383022 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-(3-hydroxy-2,6,6-trimethylcyclohexa-1,4-dien-1-yl)butan-2-one |
| SMILES | CC(=O)CCC1=C(C)C(O)C=CC1(C)C |
| InChI | InChI=1S/C13H20O2/c1-9(14)5-6-11-10(2)12(15)7-8-13(11,3)4/h7-8,12,15H,5-6H2,1-4H3 |
| InChIKey | AISPZENIMCKRLU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|