C17H16O4 — CID 122383599
(3aR,11bR,11cS)-6,6-dimethyl-3a,4,11b,11c-tetrahydro-[2]benzofuro[5,4-c]chromene-1,3-dione (PubChem CID 122383599) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is (3aR,11bR,11cS)-6,6-dimethyl-3a,4,11b,11c-tetrahydro-[2]benzofuro[5,4-c]chromene-1,3-dione.
| Compound Name | (3aR,11bR,11cS)-6,6-dimethyl-3a,4,11b,11c-tetrahydro-[2]benzofuro[5,4-c]chromene-1,3-dione |
|---|---|
| PubChem CID | 122383599 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (3aR,11bR,11cS)-6,6-dimethyl-3a,4,11b,11c-tetrahydro-[2]benzofuro[5,4-c]chromene-1,3-dione |
| SMILES | CC1(C)Oc2ccccc2[C@H]2C1=CC[C@H]1C(=O)OC(=O)[C@@H]21 |
| InChI | InChI=1S/C17H16O4/c1-17(2)11-8-7-10-14(16(19)20-15(10)18)13(11)9-5-3-4-6-12(9)21-17/h3-6,8,10,13-14H,7H2,1-2H3/t10-,13+,14-/m1/s1 |
| InChIKey | OAROGTXCTSLNAQ-DDTOSNHZSA-N |
| XLogP | 2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|