C4H4N10O4 — CID 122383921
5-(2-amino-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-amine (PubChem CID 122383921) has the molecular formula C4H4N10O4 and a molecular weight of 256.14 g/mol. Its IUPAC name is 5-(2-amino-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-amine.
| Compound Name | 5-(2-amino-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-amine |
|---|---|
| PubChem CID | 122383921 |
| Molecular Formula | C4H4N10O4 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 5-(2-amino-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-amine |
| SMILES | Nn1nc([N+](=O)[O-])nc1-c1nc([N+](=O)[O-])nn1N |
| InChI | InChI=1S/C4H4N10O4/c5-11-1(7-3(9-11)13(15)16)2-8-4(14(17)18)10-12(2)6/h5-6H2 |
| InChIKey | JDHDGYQHLBCNRH-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 199.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|