C13H14N2O3 — CID 122385359
(6R,7aS)-6-hydroxy-2-methyl-7a-phenyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 122385359) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (6R,7aS)-6-hydroxy-2-methyl-7a-phenyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (6R,7aS)-6-hydroxy-2-methyl-7a-phenyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 122385359 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (6R,7aS)-6-hydroxy-2-methyl-7a-phenyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | CN1C(=O)N2C[C@H](O)C[C@]2(c2ccccc2)C1=O |
| InChI | InChI=1S/C13H14N2O3/c1-14-11(17)13(9-5-3-2-4-6-9)7-10(16)8-15(13)12(14)18/h2-6,10,16H,7-8H2,1H3/t10-,13+/m1/s1 |
| InChIKey | HFWOUZHYDDFESG-MFKMUULPSA-N |
| XLogP | 0.54 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|