C15H20Br2O4 — CID 122385408
methyl (1S,2R,4S,4aR,8aS)-1,4-dibromo-3-oxospiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-2,2'-oxolane]-1-carboxylate (PubChem CID 122385408) has the molecular formula C15H20Br2O4 and a molecular weight of 424.13 g/mol. Its IUPAC name is methyl (1S,2R,4S,4aR,8aS)-1,4-dibromo-3-oxospiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-2,2'-oxolane]-1-carboxylate.
| Compound Name | methyl (1S,2R,4S,4aR,8aS)-1,4-dibromo-3-oxospiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-2,2'-oxolane]-1-carboxylate |
|---|---|
| PubChem CID | 122385408 |
| Molecular Formula | C15H20Br2O4 |
| Molecular Weight | 424.13 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | methyl (1S,2R,4S,4aR,8aS)-1,4-dibromo-3-oxospiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-2,2'-oxolane]-1-carboxylate |
| SMILES | COC(=O)[C@]1(Br)[C@H]2CCCC[C@H]2[C@H](Br)C(=O)[C@]12CCCO2 |
| InChI | InChI=1S/C15H20Br2O4/c1-20-13(19)15(17)10-6-3-2-5-9(10)11(16)12(18)14(15)7-4-8-21-14/h9-11H,2-8H2,1H3/t9-,10+,11+,14-,15-/m1/s1 |
| InChIKey | ZBUDLUGRCGRXON-CDYMVBJSSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|