C24H22O6 — CID 122385640
4-[4-(4-carboxyphenyl)-2,5-diethoxyphenyl]benzoic acid (PubChem CID 122385640) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is 4-[4-(4-carboxyphenyl)-2,5-diethoxyphenyl]benzoic acid.
| Compound Name | 4-[4-(4-carboxyphenyl)-2,5-diethoxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 122385640 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-[4-(4-carboxyphenyl)-2,5-diethoxyphenyl]benzoic acid |
| SMILES | CCOc1cc(-c2ccc(C(=O)O)cc2)c(OCC)cc1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H22O6/c1-3-29-21-13-20(16-7-11-18(12-8-16)24(27)28)22(30-4-2)14-19(21)15-5-9-17(10-6-15)23(25)26/h5-14H,3-4H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | XTXJWSSDDXACAQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |