C22H16F3NO3S — CID 122385712
(3S,4R)-1,3,4-triphenyl-3-(trifluoromethylsulfonyl)azetidin-2-one (PubChem CID 122385712) has the molecular formula C22H16F3NO3S and a molecular weight of 431.44 g/mol. Its IUPAC name is (3S,4R)-1,3,4-triphenyl-3-(trifluoromethylsulfonyl)azetidin-2-one.
| Compound Name | (3S,4R)-1,3,4-triphenyl-3-(trifluoromethylsulfonyl)azetidin-2-one |
|---|---|
| PubChem CID | 122385712 |
| Molecular Formula | C22H16F3NO3S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (3S,4R)-1,3,4-triphenyl-3-(trifluoromethylsulfonyl)azetidin-2-one |
| SMILES | O=C1N(c2ccccc2)[C@H](c2ccccc2)[C@]1(c1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H16F3NO3S/c23-22(24,25)30(28,29)21(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)26(20(21)27)18-14-8-3-9-15-18/h1-15,19H/t19-,21+/m1/s1 |
| InChIKey | APSIRGAOISEBJR-CTNGQTDRSA-N |
| XLogP | 4.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |