C38H44Si2 — CID 122385759
2-[2,8-ditert-butyl-12-(2-trimethylsilylethynyl)indeno[1,2-b]fluoren-6-yl]ethynyl-trimethylsilane (PubChem CID 122385759) has the molecular formula C38H44Si2 and a molecular weight of 556.94 g/mol. Its IUPAC name is 2-[2,8-ditert-butyl-12-(2-trimethylsilylethynyl)indeno[1,2-b]fluoren-6-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[2,8-ditert-butyl-12-(2-trimethylsilylethynyl)indeno[1,2-b]fluoren-6-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 122385759 |
| Molecular Formula | C38H44Si2 |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 2-[2,8-ditert-butyl-12-(2-trimethylsilylethynyl)indeno[1,2-b]fluoren-6-yl]ethynyl-trimethylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)=C(C#C[Si](C)(C)C)c1cc3c(cc1=2)C(C#C[Si](C)(C)C)=c1cc(C(C)(C)C)ccc1=3 |
| InChI | InChI=1S/C38H44Si2/c1-37(2,3)25-13-15-27-31(21-25)29(17-19-39(7,8)9)35-24-34-28-16-14-26(38(4,5)6)22-32(28)30(18-20-40(10,11)12)36(34)23-33(27)35/h13-16,21-24H,1-12H3 |
| InChIKey | FXVRXERHAFROQA-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|