C11H17N5O3 — CID 122386120
4-(2-methylpropoxy)pyridine-2,6-dicarbohydrazide (PubChem CID 122386120) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-(2-methylpropoxy)pyridine-2,6-dicarbohydrazide.
| Compound Name | 4-(2-methylpropoxy)pyridine-2,6-dicarbohydrazide |
|---|---|
| PubChem CID | 122386120 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-(2-methylpropoxy)pyridine-2,6-dicarbohydrazide |
| SMILES | CC(C)COc1cc(C(=O)NN)nc(C(=O)NN)c1 |
| InChI | InChI=1S/C11H17N5O3/c1-6(2)5-19-7-3-8(10(17)15-12)14-9(4-7)11(18)16-13/h3-4,6H,5,12-13H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | WTNDDHILBJOEDX-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|