C34H36O6 — CID 122386598
(3S,4R,5S)-6-hydroxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one (PubChem CID 122386598) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is (3S,4R,5S)-6-hydroxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one.
| Compound Name | (3S,4R,5S)-6-hydroxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one |
|---|---|
| PubChem CID | 122386598 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (3S,4R,5S)-6-hydroxy-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one |
| SMILES | O=C(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C34H36O6/c35-21-32(38-23-28-15-7-2-8-16-28)34(40-25-30-19-11-4-12-20-30)33(39-24-29-17-9-3-10-18-29)31(36)26-37-22-27-13-5-1-6-14-27/h1-20,32-35H,21-26H2/t32-,33+,34+/m0/s1 |
| InChIKey | YZLRUAPEZRUOPK-LBFZIJHGSA-N |
| XLogP | 5.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |