C28H44O6SSi — CID 122386791
(1R,5R)-4-(benzenesulfonyl)-8-methoxy-2,2-dimethyl-1-[tri(propan-2-yl)silyloxymethyl]bicyclo[3.3.1]nonane-3,9-dione (PubChem CID 122386791) has the molecular formula C28H44O6SSi and a molecular weight of 536.81 g/mol. Its IUPAC name is (1R,5R)-4-(benzenesulfonyl)-8-methoxy-2,2-dimethyl-1-[tri(propan-2-yl)silyloxymethyl]bicyclo[3.3.1]nonane-3,9-dione.
| Compound Name | (1R,5R)-4-(benzenesulfonyl)-8-methoxy-2,2-dimethyl-1-[tri(propan-2-yl)silyloxymethyl]bicyclo[3.3.1]nonane-3,9-dione |
|---|---|
| PubChem CID | 122386791 |
| Molecular Formula | C28H44O6SSi |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (1R,5R)-4-(benzenesulfonyl)-8-methoxy-2,2-dimethyl-1-[tri(propan-2-yl)silyloxymethyl]bicyclo[3.3.1]nonane-3,9-dione |
| SMILES | COC1CC[C@@H]2C(=O)[C@@]1(CO[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)C(=O)C2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H44O6SSi/c1-18(2)36(19(3)4,20(5)6)34-17-28-23(33-9)16-15-22(25(28)29)24(26(30)27(28,7)8)35(31,32)21-13-11-10-12-14-21/h10-14,18-20,22-24H,15-17H2,1-9H3/t22-,23?,24?,28-/m0/s1 |
| InChIKey | JLAJJKLHXCJHBJ-WOCARWGPSA-N |
| XLogP | 5.61 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|