C14H16O4 — CID 122386793
(E)-5,6-bis(hydroxymethyl)-2,9-dimethylidenedec-5-en-3,7-diyne-1,10-diol (PubChem CID 122386793) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (E)-5,6-bis(hydroxymethyl)-2,9-dimethylidenedec-5-en-3,7-diyne-1,10-diol.
| Compound Name | (E)-5,6-bis(hydroxymethyl)-2,9-dimethylidenedec-5-en-3,7-diyne-1,10-diol |
|---|---|
| PubChem CID | 122386793 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (E)-5,6-bis(hydroxymethyl)-2,9-dimethylidenedec-5-en-3,7-diyne-1,10-diol |
| SMILES | C=C(C#C/C(CO)=C(/C#CC(=C)CO)CO)CO |
| InChI | InChI=1S/C14H16O4/c1-11(7-15)3-5-13(9-17)14(10-18)6-4-12(2)8-16/h15-18H,1-2,7-10H2/b14-13+ |
| InChIKey | LVBDSGOMOZGKNW-BUHFOSPRSA-N |
| XLogP | -0.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|