C26H14F12N2 — CID 122388339
1-benzyl-2,5-bis[3,5-bis(trifluoromethyl)phenyl]imidazole (PubChem CID 122388339) has the molecular formula C26H14F12N2 and a molecular weight of 582.39 g/mol. Its IUPAC name is 1-benzyl-2,5-bis[3,5-bis(trifluoromethyl)phenyl]imidazole.
| Compound Name | 1-benzyl-2,5-bis[3,5-bis(trifluoromethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 122388339 |
| Molecular Formula | C26H14F12N2 |
| Molecular Weight | 582.39 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | 1-benzyl-2,5-bis[3,5-bis(trifluoromethyl)phenyl]imidazole |
| SMILES | FC(F)(F)c1cc(-c2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2Cc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H14F12N2/c27-23(28,29)17-6-15(7-18(10-17)24(30,31)32)21-12-39-22(40(21)13-14-4-2-1-3-5-14)16-8-19(25(33,34)35)11-20(9-16)26(36,37)38/h1-12H,13H2 |
| InChIKey | VQDCTKXXUVTLOS-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.39 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |