C19H17Cl2N3O4 — CID 122388519
(1S,12R,13S,17R)-1,12-dichloro-18,18-dimethoxy-6,7-dimethyl-3,10,15-triazapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4(9),5,7,10-pentaene-14,16-dione (PubChem CID 122388519) has the molecular formula C19H17Cl2N3O4 and a molecular weight of 422.27 g/mol. Its IUPAC name is (1S,12R,13S,17R)-1,12-dichloro-18,18-dimethoxy-6,7-dimethyl-3,10,15-triazapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4(9),5,7,10-pentaene-14,16-dione.
| Compound Name | (1S,12R,13S,17R)-1,12-dichloro-18,18-dimethoxy-6,7-dimethyl-3,10,15-triazapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4(9),5,7,10-pentaene-14,16-dione |
|---|---|
| PubChem CID | 122388519 |
| Molecular Formula | C19H17Cl2N3O4 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (1S,12R,13S,17R)-1,12-dichloro-18,18-dimethoxy-6,7-dimethyl-3,10,15-triazapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4(9),5,7,10-pentaene-14,16-dione |
| SMILES | COC1(OC)[C@@]2(Cl)c3nc4cc(C)c(C)cc4nc3[C@]1(Cl)[C@@H]1C(=O)NC(=O)[C@@H]12 |
| InChI | InChI=1S/C19H17Cl2N3O4/c1-7-5-9-10(6-8(7)2)23-14-13(22-9)17(20)11-12(16(26)24-15(11)25)18(14,21)19(17,27-3)28-4/h5-6,11-12H,1-4H3,(H,24,25,26)/t11-,12+,17+,18- |
| InChIKey | MYIJKRSDXARWHE-KZBLUPIWSA-N |
| XLogP | 2.02 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|