C40H38N4 — CID 122388803
(9Z)-4,5,14,15-tetrakis(4-methylphenyl)-3,6,13,16-tetrazatricyclo[11.3.0.02,6]hexadeca-1(16),2,4,9,14-pentaene (PubChem CID 122388803) has the molecular formula C40H38N4 and a molecular weight of 574.77 g/mol. Its IUPAC name is (9Z)-4,5,14,15-tetrakis(4-methylphenyl)-3,6,13,16-tetrazatricyclo[11.3.0.02,6]hexadeca-1(16),2,4,9,14-pentaene.
| Compound Name | (9Z)-4,5,14,15-tetrakis(4-methylphenyl)-3,6,13,16-tetrazatricyclo[11.3.0.02,6]hexadeca-1(16),2,4,9,14-pentaene |
|---|---|
| PubChem CID | 122388803 |
| Molecular Formula | C40H38N4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | (9Z)-4,5,14,15-tetrakis(4-methylphenyl)-3,6,13,16-tetrazatricyclo[11.3.0.02,6]hexadeca-1(16),2,4,9,14-pentaene |
| SMILES | Cc1ccc(-c2nc3n(c2-c2ccc(C)cc2)CC/C=C\CCn2c-3nc(-c3ccc(C)cc3)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H38N4/c1-27-9-17-31(18-10-27)35-37(33-21-13-29(3)14-22-33)43-25-7-5-6-8-26-44-38(34-23-15-30(4)16-24-34)36(42-40(44)39(43)41-35)32-19-11-28(2)12-20-32/h5-6,9-24H,7-8,25-26H2,1-4H3/b6-5- |
| InChIKey | RTKYNMHEDIBMBY-WAYWQWQTSA-N |
| XLogP | 10.00 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|