C23H23NO4 — CID 122388994
(3S,4aR,8aS)-8-hydroxy-2-(4-methoxyphenyl)-8a-methyl-3-phenyl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione (PubChem CID 122388994) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is (3S,4aR,8aS)-8-hydroxy-2-(4-methoxyphenyl)-8a-methyl-3-phenyl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione.
| Compound Name | (3S,4aR,8aS)-8-hydroxy-2-(4-methoxyphenyl)-8a-methyl-3-phenyl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione |
|---|---|
| PubChem CID | 122388994 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (3S,4aR,8aS)-8-hydroxy-2-(4-methoxyphenyl)-8a-methyl-3-phenyl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione |
| SMILES | COc1ccc(N2C(=O)[C@]3(C)C(O)=CC(=O)C[C@H]3C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-23-16(12-18(25)14-21(23)26)13-20(15-6-4-3-5-7-15)24(22(23)27)17-8-10-19(28-2)11-9-17/h3-11,14,16,20,26H,12-13H2,1-2H3/t16-,20-,23-/m0/s1 |
| InChIKey | QMPIPNDICJZPCC-GRWTVWFQSA-N |
| XLogP | 4.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |