C15H26F2OSi — CID 122389929
tert-butyl-[(2,2-difluoro-3,3a,4,5,6,7-hexahydroinden-1-yl)oxy]-dimethylsilane (PubChem CID 122389929) has the molecular formula C15H26F2OSi and a molecular weight of 288.45 g/mol. Its IUPAC name is tert-butyl-[(2,2-difluoro-3,3a,4,5,6,7-hexahydroinden-1-yl)oxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2,2-difluoro-3,3a,4,5,6,7-hexahydroinden-1-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 122389929 |
| Molecular Formula | C15H26F2OSi |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | tert-butyl-[(2,2-difluoro-3,3a,4,5,6,7-hexahydroinden-1-yl)oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2CCCCC2CC1(F)F |
| InChI | InChI=1S/C15H26F2OSi/c1-14(2,3)19(4,5)18-13-12-9-7-6-8-11(12)10-15(13,16)17/h11H,6-10H2,1-5H3 |
| InChIKey | LMFARMYBOHILDC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|