About (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate
(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate (PubChem CID 122390286) has the molecular formula C25H31NO3
and a molecular weight of 393.53 g/mol. Its IUPAC name is (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate.
Molecular Properties
| Compound Name | (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate |
| PubChem CID | 122390286 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)Oc1ccc2c(c1)CN(c1ccccc1)CO2 |
| InChI | InChI=1S/C25H31NO3/c1-2-3-4-5-6-7-8-12-15-25(27)29-23-16-17-24-21(18-23)19-26(20-28-24)22-13-10-9-11-14-22/h2,9-11,13-14,16-18H,1,3-8,12,15,19-20H2 |
| InChIKey | SABWFKJXHISHFP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate?
The IUPAC name of (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate (CID 122390286) is (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate.
What is the SMILES notation for (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate?
The canonical SMILES for (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate is C=CCCCCCCCCC(=O)Oc1ccc2c(c1)CN(c1ccccc1)CO2.
What is the InChIKey of (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate?
The InChIKey is SABWFKJXHISHFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31NO3/c1-2-3-4-5-6-7-8-12-15-25(27)29-23-16-17-24-21(18-23)19-26(20-28-24)22-13-10-9-11-14-22/h2,9-11,13-14,16-18H,1,3-8,12,15,19-20H2.
What are the key properties of (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate?
(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate has a molecular weight of 393.53 g/mol, XLogP of 6.26, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl) undec-10-enoate is sourced from PubChem (CID 122390286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).