C19H32O5Si — CID 122390336
methyl (1R,4S,8S,9R,10R,12R)-4,8,10-trimethyl-3-oxo-9-trimethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodecane-9-carboxylate (PubChem CID 122390336) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is methyl (1R,4S,8S,9R,10R,12R)-4,8,10-trimethyl-3-oxo-9-trimethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodecane-9-carboxylate.
| Compound Name | methyl (1R,4S,8S,9R,10R,12R)-4,8,10-trimethyl-3-oxo-9-trimethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodecane-9-carboxylate |
|---|---|
| PubChem CID | 122390336 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | methyl (1R,4S,8S,9R,10R,12R)-4,8,10-trimethyl-3-oxo-9-trimethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodecane-9-carboxylate |
| SMILES | COC(=O)[C@@]1(O[Si](C)(C)C)[C@H](C)C[C@H]2OC(=O)[C@@]3(C)CCC[C@@]1(C)[C@@H]23 |
| InChI | InChI=1S/C19H32O5Si/c1-12-11-13-14-17(2,15(20)23-13)9-8-10-18(14,3)19(12,16(21)22-4)24-25(5,6)7/h12-14H,8-11H2,1-7H3/t12-,13-,14+,17+,18+,19+/m1/s1 |
| InChIKey | ARGAVTJJAUEUTC-AYVLHYGGSA-N |
| XLogP | 3.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|