C22H24N2O9 — CID 122391248
(4S,4aS,5aR,6S,11aS,12aR)-2-carbamoyl-4-(dimethylazaniumyl)-6,10,11a,12a-tetrahydroxy-6-methyl-3,11,12-trioxo-4,4a,5,5a-tetrahydrotetracen-1-olate (PubChem CID 122391248) has the molecular formula C22H24N2O9 and a molecular weight of 460.44 g/mol. Its IUPAC name is (4S,4aS,5aR,6S,11aS,12aR)-2-carbamoyl-4-(dimethylazaniumyl)-6,10,11a,12a-tetrahydroxy-6-methyl-3,11,12-trioxo-4,4a,5,5a-tetrahydrotetracen-1-olate.
| Compound Name | (4S,4aS,5aR,6S,11aS,12aR)-2-carbamoyl-4-(dimethylazaniumyl)-6,10,11a,12a-tetrahydroxy-6-methyl-3,11,12-trioxo-4,4a,5,5a-tetrahydrotetracen-1-olate |
|---|---|
| PubChem CID | 122391248 |
| Molecular Formula | C22H24N2O9 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (4S,4aS,5aR,6S,11aS,12aR)-2-carbamoyl-4-(dimethylazaniumyl)-6,10,11a,12a-tetrahydroxy-6-methyl-3,11,12-trioxo-4,4a,5,5a-tetrahydrotetracen-1-olate |
| SMILES | C[NH+](C)[C@@H]1C(=O)C(C(N)=O)=C([O-])[C@@]2(O)C(=O)[C@@]3(O)C(=O)c4c(O)cccc4[C@@](C)(O)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C22H24N2O9/c1-20(31)8-5-4-6-10(25)12(8)16(27)22(33)11(20)7-9-14(24(2)3)15(26)13(18(23)29)17(28)21(9,32)19(22)30/h4-6,9,11,14,25,28,31-33H,7H2,1-3H3,(H2,23,29)/t9-,11+,14-,20+,21+,22-/m0/s1 |
| InChIKey | WHSQPFARTNPSDO-BWOONYPSSA-N |
| XLogP | -4.34 |
| TPSA | 202.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|