C22H34N2O5 — CID 122391815
ditert-butyl (1S,4S,7R,10R)-2-oxo-3,14-diazatricyclo[8.4.0.03,7]tetradec-8-ene-4,14-dicarboxylate (PubChem CID 122391815) has the molecular formula C22H34N2O5 and a molecular weight of 406.52 g/mol. Its IUPAC name is ditert-butyl (1S,4S,7R,10R)-2-oxo-3,14-diazatricyclo[8.4.0.03,7]tetradec-8-ene-4,14-dicarboxylate.
| Compound Name | ditert-butyl (1S,4S,7R,10R)-2-oxo-3,14-diazatricyclo[8.4.0.03,7]tetradec-8-ene-4,14-dicarboxylate |
|---|---|
| PubChem CID | 122391815 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | ditert-butyl (1S,4S,7R,10R)-2-oxo-3,14-diazatricyclo[8.4.0.03,7]tetradec-8-ene-4,14-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC[C@@H]2C=C[C@H]3CCCN(C(=O)OC(C)(C)C)[C@@H]3C(=O)N21 |
| InChI | InChI=1S/C22H34N2O5/c1-21(2,3)28-19(26)16-12-11-15-10-9-14-8-7-13-23(17(14)18(25)24(15)16)20(27)29-22(4,5)6/h9-10,14-17H,7-8,11-13H2,1-6H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | NEFSVKZCMNLRPE-QZWWFDLISA-N |
| XLogP | 3.27 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|