C10H19NO3 — CID 122392067
(1R,2R,3S,5S,8aR)-3-(hydroxymethyl)-5-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol (PubChem CID 122392067) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (1R,2R,3S,5S,8aR)-3-(hydroxymethyl)-5-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol.
| Compound Name | (1R,2R,3S,5S,8aR)-3-(hydroxymethyl)-5-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
|---|---|
| PubChem CID | 122392067 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (1R,2R,3S,5S,8aR)-3-(hydroxymethyl)-5-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
| SMILES | C[C@H]1CCC[C@@H]2[C@@H](O)[C@H](O)[C@H](CO)N21 |
| InChI | InChI=1S/C10H19NO3/c1-6-3-2-4-7-9(13)10(14)8(5-12)11(6)7/h6-10,12-14H,2-5H2,1H3/t6-,7+,8-,9+,10+/m0/s1 |
| InChIKey | WWCHNEZLPVURTG-SQXHDICFSA-N |
| XLogP | -0.67 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |