C25H27N7O2 — CID 122392665
(2S)-2-[(2-benzhydryl-1H-imidazo[4,5-c]pyridin-4-yl)amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 122392665) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is (2S)-2-[(2-benzhydryl-1H-imidazo[4,5-c]pyridin-4-yl)amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[(2-benzhydryl-1H-imidazo[4,5-c]pyridin-4-yl)amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 122392665 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (2S)-2-[(2-benzhydryl-1H-imidazo[4,5-c]pyridin-4-yl)amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](Nc1nccc2[nH]c(C(c3ccccc3)c3ccccc3)nc12)C(=O)O |
| InChI | InChI=1S/C25H27N7O2/c26-25(27)29-14-7-12-19(24(33)34)31-23-21-18(13-15-28-23)30-22(32-21)20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,13,15,19-20H,7,12,14H2,(H,28,31)(H,30,32)(H,33,34)(H4,26,27,29)/t19-/m0/s1 |
| InChIKey | BLPSFEYRICSLKY-IBGZPJMESA-N |
| XLogP | 3.06 |
| TPSA | 155.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|