C14H22O4 — CID 122392803
methyl (5E,7R)-2-tert-butyl-7-hydroxy-8-methoxyocta-2,3,5-trienoate (PubChem CID 122392803) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl (5E,7R)-2-tert-butyl-7-hydroxy-8-methoxyocta-2,3,5-trienoate.
| Compound Name | methyl (5E,7R)-2-tert-butyl-7-hydroxy-8-methoxyocta-2,3,5-trienoate |
|---|---|
| PubChem CID | 122392803 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | methyl (5E,7R)-2-tert-butyl-7-hydroxy-8-methoxyocta-2,3,5-trienoate |
| SMILES | COC[C@H](O)/C=C/C=C=C(C(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C14H22O4/c1-14(2,3)12(13(16)18-5)9-7-6-8-11(15)10-17-4/h6-8,11,15H,10H2,1-5H3/b8-6+/t9?,11-/m1/s1 |
| InChIKey | GOQCKFMKPKVWAN-XSSCVWDPSA-N |
| XLogP | 1.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|