C24H20O2 — CID 122393201
(3E,3aR,7aR)-7a-methyl-3-(phenanthren-9-ylmethylidene)-3a,4-dihydro-1-benzofuran-5-one (PubChem CID 122393201) has the molecular formula C24H20O2 and a molecular weight of 340.42 g/mol. Its IUPAC name is (3E,3aR,7aR)-7a-methyl-3-(phenanthren-9-ylmethylidene)-3a,4-dihydro-1-benzofuran-5-one.
| Compound Name | (3E,3aR,7aR)-7a-methyl-3-(phenanthren-9-ylmethylidene)-3a,4-dihydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 122393201 |
| Molecular Formula | C24H20O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (3E,3aR,7aR)-7a-methyl-3-(phenanthren-9-ylmethylidene)-3a,4-dihydro-1-benzofuran-5-one |
| SMILES | C[C@@]12C=CC(=O)C[C@@H]1/C(=C\c1cc3ccccc3c3ccccc13)CO2 |
| InChI | InChI=1S/C24H20O2/c1-24-11-10-19(25)14-23(24)18(15-26-24)13-17-12-16-6-2-3-7-20(16)22-9-5-4-8-21(17)22/h2-13,23H,14-15H2,1H3/b18-13-/t23-,24-/m1/s1 |
| InChIKey | CVOMKDRRBSAIAK-FAAVFHQWSA-N |
| XLogP | 5.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|