C21H40O4Si2 — CID 122393365
(1R)-1-[(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 122393365) has the molecular formula C21H40O4Si2 and a molecular weight of 412.72 g/mol. Its IUPAC name is (1R)-1-[(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1R)-1-[(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 122393365 |
| Molecular Formula | C21H40O4Si2 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (1R)-1-[(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | CC(C)O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C=C[C@@H]1[C@@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C21H40O4Si2/c1-16(2)24-20-18(19(22)13-14-26(6,7)8)12-11-17(25-20)15-23-27(9,10)21(3,4)5/h11-12,16-20,22H,15H2,1-10H3/t17-,18+,19-,20-/m0/s1 |
| InChIKey | AGCXHVDJVRRNCQ-YRPNKDGESA-N |
| XLogP | 4.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|